C12H17IO3 — CID 146233693
(3aS,7R,7aS)-7a-(iodomethyl)-7-(2-oxopropyl)-3,3a,4,5,6,7-hexahydro-1-benzofuran-2-one (PubChem CID 146233693) has the molecular formula C12H17IO3 and a molecular weight of 336.17 g/mol. Its IUPAC name is (3aS,7R,7aS)-7a-(iodomethyl)-7-(2-oxopropyl)-3,3a,4,5,6,7-hexahydro-1-benzofuran-2-one.
| Compound Name | (3aS,7R,7aS)-7a-(iodomethyl)-7-(2-oxopropyl)-3,3a,4,5,6,7-hexahydro-1-benzofuran-2-one |
|---|---|
| PubChem CID | 146233693 |
| Molecular Formula | C12H17IO3 |
| Molecular Weight | 336.17 g/mol |
| Exact Mass | 336.02 |
| IUPAC Name | (3aS,7R,7aS)-7a-(iodomethyl)-7-(2-oxopropyl)-3,3a,4,5,6,7-hexahydro-1-benzofuran-2-one |
| SMILES | CC(=O)C[C@H]1CCC[C@H]2CC(=O)O[C@@]12CI |
| InChI | InChI=1S/C12H17IO3/c1-8(14)5-9-3-2-4-10-6-11(15)16-12(9,10)7-13/h9-10H,2-7H2,1H3/t9-,10+,12+/m1/s1 |
| InChIKey | NKYLZCNSVSYROU-SCVCMEIPSA-N |
| XLogP | 2.50 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.17 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|