C29H27Cl2NO6 — CID 10257123
(1,4-dihydroxy-9,10-dioxoanthracen-2-yl)methyl 4-[4-[bis(2-chloroethyl)amino]phenyl]butanoate (PubChem CID 10257123) has the molecular formula C29H27Cl2NO6 and a molecular weight of 556.44 g/mol. Its IUPAC name is (1,4-dihydroxy-9,10-dioxoanthracen-2-yl)methyl 4-[4-[bis(2-chloroethyl)amino]phenyl]butanoate.
| Compound Name | (1,4-dihydroxy-9,10-dioxoanthracen-2-yl)methyl 4-[4-[bis(2-chloroethyl)amino]phenyl]butanoate |
|---|---|
| PubChem CID | 10257123 |
| Molecular Formula | C29H27Cl2NO6 |
| Molecular Weight | 556.44 g/mol |
| Exact Mass | 555.12 |
| IUPAC Name | (1,4-dihydroxy-9,10-dioxoanthracen-2-yl)methyl 4-[4-[bis(2-chloroethyl)amino]phenyl]butanoate |
| SMILES | O=C(CCCc1ccc(N(CCCl)CCCl)cc1)OCc1cc(O)c2c(c1O)C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C29H27Cl2NO6/c30-12-14-32(15-13-31)20-10-8-18(9-11-20)4-3-7-24(34)38-17-19-16-23(33)25-26(27(19)35)29(37)22-6-2-1-5-21(22)28(25)36/h1-2,5-6,8-11,16,33,35H,3-4,7,12-15,17H2 |
| InChIKey | WPWFVJOTCDVMMO-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 104.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.44 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|