C30H29Cl2NO6 — CID 10907920
1-(1,4-dihydroxy-9,10-dioxoanthracen-2-yl)ethyl 4-[4-[bis(2-chloroethyl)amino]phenyl]butanoate (PubChem CID 10907920) has the molecular formula C30H29Cl2NO6 and a molecular weight of 570.47 g/mol. Its IUPAC name is 1-(1,4-dihydroxy-9,10-dioxoanthracen-2-yl)ethyl 4-[4-[bis(2-chloroethyl)amino]phenyl]butanoate.
| Compound Name | 1-(1,4-dihydroxy-9,10-dioxoanthracen-2-yl)ethyl 4-[4-[bis(2-chloroethyl)amino]phenyl]butanoate |
|---|---|
| PubChem CID | 10907920 |
| Molecular Formula | C30H29Cl2NO6 |
| Molecular Weight | 570.47 g/mol |
| Exact Mass | 569.14 |
| IUPAC Name | 1-(1,4-dihydroxy-9,10-dioxoanthracen-2-yl)ethyl 4-[4-[bis(2-chloroethyl)amino]phenyl]butanoate |
| SMILES | CC(OC(=O)CCCc1ccc(N(CCCl)CCCl)cc1)c1cc(O)c2c(c1O)C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C30H29Cl2NO6/c1-18(39-25(35)8-4-5-19-9-11-20(12-10-19)33(15-13-31)16-14-32)23-17-24(34)26-27(30(23)38)29(37)22-7-3-2-6-21(22)28(26)36/h2-3,6-7,9-12,17-18,34,38H,4-5,8,13-16H2,1H3 |
| InChIKey | CJZXRHWGNQRCGO-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 104.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.47 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|