C23H38ClNO — CID 102571937
(E)-N-chloro-N-[(3-methoxyphenyl)methyl]pentadec-4-en-8-amine (PubChem CID 102571937) has the molecular formula C23H38ClNO and a molecular weight of 380.02 g/mol. Its IUPAC name is (E)-N-chloro-N-[(3-methoxyphenyl)methyl]pentadec-4-en-8-amine.
| Compound Name | (E)-N-chloro-N-[(3-methoxyphenyl)methyl]pentadec-4-en-8-amine |
|---|---|
| PubChem CID | 102571937 |
| Molecular Formula | C23H38ClNO |
| Molecular Weight | 380.02 g/mol |
| Exact Mass | 379.26 |
| IUPAC Name | (E)-N-chloro-N-[(3-methoxyphenyl)methyl]pentadec-4-en-8-amine |
| SMILES | CCC/C=C/CCC(CCCCCCC)N(Cl)Cc1cccc(OC)c1 |
| InChI | InChI=1S/C23H38ClNO/c1-4-6-8-10-12-16-22(17-13-11-9-7-5-2)25(24)20-21-15-14-18-23(19-21)26-3/h8,10,14-15,18-19,22H,4-7,9,11-13,16-17,20H2,1-3H3/b10-8+ |
| InChIKey | BPGZGQVUIPBQFX-CSKARUKUSA-N |
| XLogP | 7.52 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.02 |
| LogP ≤ 5 | 7.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|