C20H27NO2 — CID 93162073
(2S)-1-[benzyl-[(3-methoxyphenyl)methyl]amino]pentan-2-ol (PubChem CID 93162073) has the molecular formula C20H27NO2 and a molecular weight of 313.44 g/mol. Its IUPAC name is (2S)-1-[benzyl-[(3-methoxyphenyl)methyl]amino]pentan-2-ol.
| Compound Name | (2S)-1-[benzyl-[(3-methoxyphenyl)methyl]amino]pentan-2-ol |
|---|---|
| PubChem CID | 93162073 |
| Molecular Formula | C20H27NO2 |
| Molecular Weight | 313.44 g/mol |
| Exact Mass | 313.20 |
| IUPAC Name | (2S)-1-[benzyl-[(3-methoxyphenyl)methyl]amino]pentan-2-ol |
| SMILES | CCC[C@H](O)CN(Cc1ccccc1)Cc1cccc(OC)c1 |
| InChI | InChI=1S/C20H27NO2/c1-3-8-19(22)16-21(14-17-9-5-4-6-10-17)15-18-11-7-12-20(13-18)23-2/h4-7,9-13,19,22H,3,8,14-16H2,1-2H3/t19-/m0/s1 |
| InChIKey | PLTVHDZGHPNAED-IBGZPJMESA-N |
| XLogP | 3.86 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.44 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |