C8H11FO4 — CID 102572845
[(3S)-4,4-dimethyl-2-oxooxolan-3-yl] 2-fluoroacetate (PubChem CID 102572845) has the molecular formula C8H11FO4 and a molecular weight of 190.17 g/mol. Its IUPAC name is [(3S)-4,4-dimethyl-2-oxooxolan-3-yl] 2-fluoroacetate.
| Compound Name | [(3S)-4,4-dimethyl-2-oxooxolan-3-yl] 2-fluoroacetate |
|---|---|
| PubChem CID | 102572845 |
| Molecular Formula | C8H11FO4 |
| Molecular Weight | 190.17 g/mol |
| Exact Mass | 190.06 |
| IUPAC Name | [(3S)-4,4-dimethyl-2-oxooxolan-3-yl] 2-fluoroacetate |
| SMILES | CC1(C)COC(=O)[C@H]1OC(=O)CF |
| InChI | InChI=1S/C8H11FO4/c1-8(2)4-12-7(11)6(8)13-5(10)3-9/h6H,3-4H2,1-2H3/t6-/m1/s1 |
| InChIKey | RCYGORNKQZXQLD-ZCFIWIBFSA-N |
| XLogP | 0.45 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.17 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |