C25H40N3O4S- — CID 102572882
2-[4-(carboxymethyl)-7-[(3,5-ditert-butyl-2-sulfanylphenyl)methyl]-1,4,7-triazonan-1-yl]acetate (PubChem CID 102572882) has the molecular formula C25H40N3O4S- and a molecular weight of 478.68 g/mol. Its IUPAC name is 2-[4-(carboxymethyl)-7-[(3,5-ditert-butyl-2-sulfanylphenyl)methyl]-1,4,7-triazonan-1-yl]acetate.
| Compound Name | 2-[4-(carboxymethyl)-7-[(3,5-ditert-butyl-2-sulfanylphenyl)methyl]-1,4,7-triazonan-1-yl]acetate |
|---|---|
| PubChem CID | 102572882 |
| Molecular Formula | C25H40N3O4S- |
| Molecular Weight | 478.68 g/mol |
| Exact Mass | 478.27 |
| IUPAC Name | 2-[4-(carboxymethyl)-7-[(3,5-ditert-butyl-2-sulfanylphenyl)methyl]-1,4,7-triazonan-1-yl]acetate |
| SMILES | CC(C)(C)c1cc(CN2CCN(CC(=O)[O-])CCN(CC(=O)O)CC2)c(S)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C25H41N3O4S/c1-24(2,3)19-13-18(23(33)20(14-19)25(4,5)6)15-26-7-9-27(16-21(29)30)11-12-28(10-8-26)17-22(31)32/h13-14,33H,7-12,15-17H2,1-6H3,(H,29,30)(H,31,32)/p-1 |
| InChIKey | QCZUFRAPPXGKNM-UHFFFAOYSA-M |
| XLogP | 1.82 |
| TPSA | 87.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.68 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|