C32H51N5O9 — CID 23371156
2-[4,7-bis(carboxymethyl)-10-[2-[3,5-ditert-butyl-N-(carboxymethyl)anilino]-2-oxoethyl]-1,4,7,10-tetrazacyclododec-1-yl]acetic acid (PubChem CID 23371156) has the molecular formula C32H51N5O9 and a molecular weight of 649.79 g/mol. Its IUPAC name is 2-[4,7-bis(carboxymethyl)-10-[2-[3,5-ditert-butyl-N-(carboxymethyl)anilino]-2-oxoethyl]-1,4,7,10-tetrazacyclododec-1-yl]acetic acid.
| Compound Name | 2-[4,7-bis(carboxymethyl)-10-[2-[3,5-ditert-butyl-N-(carboxymethyl)anilino]-2-oxoethyl]-1,4,7,10-tetrazacyclododec-1-yl]acetic acid |
|---|---|
| PubChem CID | 23371156 |
| Molecular Formula | C32H51N5O9 |
| Molecular Weight | 649.79 g/mol |
| Exact Mass | 649.37 |
| IUPAC Name | 2-[4,7-bis(carboxymethyl)-10-[2-[3,5-ditert-butyl-N-(carboxymethyl)anilino]-2-oxoethyl]-1,4,7,10-tetrazacyclododec-1-yl]acetic acid |
| SMILES | CC(C)(C)c1cc(N(CC(=O)O)C(=O)CN2CCN(CC(=O)O)CCN(CC(=O)O)CCN(CC(=O)O)CC2)cc(C(C)(C)C)c1 |
| InChI | InChI=1S/C32H51N5O9/c1-31(2,3)23-15-24(32(4,5)6)17-25(16-23)37(22-30(45)46)26(38)18-33-7-9-34(19-27(39)40)11-13-36(21-29(43)44)14-12-35(10-8-33)20-28(41)42/h15-17H,7-14,18-22H2,1-6H3,(H,39,40)(H,41,42)(H,43,44)(H,45,46) |
| InChIKey | IGEICLKSTSGZFY-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 182.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.79 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |