C28H49N7O14 — CID 118005296
2-[4,7,10-tris[2-[bis(carboxymethyl)amino]ethyl]-1,4,7,10-tetrazacyclododec-1-yl]acetic acid (PubChem CID 118005296) has the molecular formula C28H49N7O14 and a molecular weight of 707.73 g/mol. Its IUPAC name is 2-[4,7,10-tris[2-[bis(carboxymethyl)amino]ethyl]-1,4,7,10-tetrazacyclododec-1-yl]acetic acid.
| Compound Name | 2-[4,7,10-tris[2-[bis(carboxymethyl)amino]ethyl]-1,4,7,10-tetrazacyclododec-1-yl]acetic acid |
|---|---|
| PubChem CID | 118005296 |
| Molecular Formula | C28H49N7O14 |
| Molecular Weight | 707.73 g/mol |
| Exact Mass | 707.33 |
| IUPAC Name | 2-[4,7,10-tris[2-[bis(carboxymethyl)amino]ethyl]-1,4,7,10-tetrazacyclododec-1-yl]acetic acid |
| SMILES | O=C(O)CN1CCN(CCN(CC(=O)O)CC(=O)O)CCN(CCN(CC(=O)O)CC(=O)O)CCN(CCN(CC(=O)O)CC(=O)O)CC1 |
| InChI | InChI=1S/C28H49N7O14/c36-22(37)15-32-10-5-30(8-13-34(18-25(42)43)19-26(44)45)3-1-29(7-12-33(16-23(38)39)17-24(40)41)2-4-31(6-11-32)9-14-35(20-27(46)47)21-28(48)49/h1-21H2,(H,36,37)(H,38,39)(H,40,41)(H,42,43)(H,44,45)(H,46,47)(H,48,49) |
| InChIKey | AGBGSXVQFZFVGN-UHFFFAOYSA-N |
| XLogP | -4.29 |
| TPSA | 283.78 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 49 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 707.73 |
| LogP ≤ 5 | -4.29 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 14 |