C16H27IN4O7 — CID 138736147
2-[4-[2-[bis(carboxymethyl)amino]ethyl]-7-(2-iodo-2-oxoethyl)-1,4,7-triazonan-1-yl]acetic acid (PubChem CID 138736147) has the molecular formula C16H27IN4O7 and a molecular weight of 514.32 g/mol. Its IUPAC name is 2-[4-[2-[bis(carboxymethyl)amino]ethyl]-7-(2-iodo-2-oxoethyl)-1,4,7-triazonan-1-yl]acetic acid.
| Compound Name | 2-[4-[2-[bis(carboxymethyl)amino]ethyl]-7-(2-iodo-2-oxoethyl)-1,4,7-triazonan-1-yl]acetic acid |
|---|---|
| PubChem CID | 138736147 |
| Molecular Formula | C16H27IN4O7 |
| Molecular Weight | 514.32 g/mol |
| Exact Mass | 514.09 |
| IUPAC Name | 2-[4-[2-[bis(carboxymethyl)amino]ethyl]-7-(2-iodo-2-oxoethyl)-1,4,7-triazonan-1-yl]acetic acid |
| SMILES | O=C(O)CN1CCN(CCN(CC(=O)O)CC(=O)O)CCN(CC(=O)I)CC1 |
| InChI | InChI=1S/C16H27IN4O7/c17-13(22)9-19-4-1-18(2-5-20(7-6-19)10-14(23)24)3-8-21(11-15(25)26)12-16(27)28/h1-12H2,(H,23,24)(H,25,26)(H,27,28) |
| InChIKey | YPHGZOKWAQVJJL-UHFFFAOYSA-N |
| XLogP | -1.58 |
| TPSA | 141.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.32 |
| LogP ≤ 5 | -1.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|