C25H25NO — CID 102572936
4-methyl-4,6-diphenyl-2-propan-2-yl-3H-isoquinolin-1-one (PubChem CID 102572936) has the molecular formula C25H25NO and a molecular weight of 355.48 g/mol. Its IUPAC name is 4-methyl-4,6-diphenyl-2-propan-2-yl-3H-isoquinolin-1-one.
| Compound Name | 4-methyl-4,6-diphenyl-2-propan-2-yl-3H-isoquinolin-1-one |
|---|---|
| PubChem CID | 102572936 |
| Molecular Formula | C25H25NO |
| Molecular Weight | 355.48 g/mol |
| Exact Mass | 355.19 |
| IUPAC Name | 4-methyl-4,6-diphenyl-2-propan-2-yl-3H-isoquinolin-1-one |
| SMILES | CC(C)N1CC(C)(c2ccccc2)c2cc(-c3ccccc3)ccc2C1=O |
| InChI | InChI=1S/C25H25NO/c1-18(2)26-17-25(3,21-12-8-5-9-13-21)23-16-20(14-15-22(23)24(26)27)19-10-6-4-7-11-19/h4-16,18H,17H2,1-3H3 |
| InChIKey | IPBGLSCZPSWAGK-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.48 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |