C18H22O6 — CID 102573508
[(3S,6R)-6-[3-[(3S,6R)-3-acetyloxy-3,6-dihydro-2H-pyran-6-yl]buta-1,3-dien-2-yl]-3,6-dihydro-2H-pyran-3-yl] acetate (PubChem CID 102573508) has the molecular formula C18H22O6 and a molecular weight of 334.37 g/mol. Its IUPAC name is [(3S,6R)-6-[3-[(3S,6R)-3-acetyloxy-3,6-dihydro-2H-pyran-6-yl]buta-1,3-dien-2-yl]-3,6-dihydro-2H-pyran-3-yl] acetate.
| Compound Name | [(3S,6R)-6-[3-[(3S,6R)-3-acetyloxy-3,6-dihydro-2H-pyran-6-yl]buta-1,3-dien-2-yl]-3,6-dihydro-2H-pyran-3-yl] acetate |
|---|---|
| PubChem CID | 102573508 |
| Molecular Formula | C18H22O6 |
| Molecular Weight | 334.37 g/mol |
| Exact Mass | 334.14 |
| IUPAC Name | [(3S,6R)-6-[3-[(3S,6R)-3-acetyloxy-3,6-dihydro-2H-pyran-6-yl]buta-1,3-dien-2-yl]-3,6-dihydro-2H-pyran-3-yl] acetate |
| SMILES | C=C(C(=C)[C@H]1C=C[C@H](OC(C)=O)CO1)[C@H]1C=C[C@H](OC(C)=O)CO1 |
| InChI | InChI=1S/C18H22O6/c1-11(17-7-5-15(9-21-17)23-13(3)19)12(2)18-8-6-16(10-22-18)24-14(4)20/h5-8,15-18H,1-2,9-10H2,3-4H3/t15-,16-,17+,18+/m0/s1 |
| InChIKey | STIBBIBQPMANNE-WNRNVDISSA-N |
| XLogP | 1.87 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.37 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|