C26H30N2O5Si — CID 102574385
methyl (2S,3R)-5-benzamido-2-cyano-3-[dimethyl(prop-2-enyl)silyl]-2-(4-methoxyphenyl)-5-oxopentanoate (PubChem CID 102574385) has the molecular formula C26H30N2O5Si and a molecular weight of 478.62 g/mol. Its IUPAC name is methyl (2S,3R)-5-benzamido-2-cyano-3-[dimethyl(prop-2-enyl)silyl]-2-(4-methoxyphenyl)-5-oxopentanoate.
| Compound Name | methyl (2S,3R)-5-benzamido-2-cyano-3-[dimethyl(prop-2-enyl)silyl]-2-(4-methoxyphenyl)-5-oxopentanoate |
|---|---|
| PubChem CID | 102574385 |
| Molecular Formula | C26H30N2O5Si |
| Molecular Weight | 478.62 g/mol |
| Exact Mass | 478.19 |
| IUPAC Name | methyl (2S,3R)-5-benzamido-2-cyano-3-[dimethyl(prop-2-enyl)silyl]-2-(4-methoxyphenyl)-5-oxopentanoate |
| SMILES | C=CC[Si](C)(C)[C@H](CC(=O)NC(=O)c1ccccc1)[C@@](C#N)(C(=O)OC)c1ccc(OC)cc1 |
| InChI | InChI=1S/C26H30N2O5Si/c1-6-16-34(4,5)22(17-23(29)28-24(30)19-10-8-7-9-11-19)26(18-27,25(31)33-3)20-12-14-21(32-2)15-13-20/h6-15,22H,1,16-17H2,2-5H3,(H,28,29,30)/t22-,26+/m1/s1 |
| InChIKey | FRNGQEKFHGLUII-GJZUVCINSA-N |
| XLogP | 4.24 |
| TPSA | 105.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.62 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|