C26H40N2O6Si — CID 102255343
methyl (3R)-8-[tert-butyl(dimethyl)silyl]oxy-2-cyano-3-[2-[(2-methoxybenzoyl)amino]-2-oxoethyl]octanoate (PubChem CID 102255343) has the molecular formula C26H40N2O6Si and a molecular weight of 504.70 g/mol. Its IUPAC name is methyl (3R)-8-[tert-butyl(dimethyl)silyl]oxy-2-cyano-3-[2-[(2-methoxybenzoyl)amino]-2-oxoethyl]octanoate.
| Compound Name | methyl (3R)-8-[tert-butyl(dimethyl)silyl]oxy-2-cyano-3-[2-[(2-methoxybenzoyl)amino]-2-oxoethyl]octanoate |
|---|---|
| PubChem CID | 102255343 |
| Molecular Formula | C26H40N2O6Si |
| Molecular Weight | 504.70 g/mol |
| Exact Mass | 504.27 |
| IUPAC Name | methyl (3R)-8-[tert-butyl(dimethyl)silyl]oxy-2-cyano-3-[2-[(2-methoxybenzoyl)amino]-2-oxoethyl]octanoate |
| SMILES | COC(=O)C(C#N)[C@H](CCCCCO[Si](C)(C)C(C)(C)C)CC(=O)NC(=O)c1ccccc1OC |
| InChI | InChI=1S/C26H40N2O6Si/c1-26(2,3)35(6,7)34-16-12-8-9-13-19(21(18-27)25(31)33-5)17-23(29)28-24(30)20-14-10-11-15-22(20)32-4/h10-11,14-15,19,21H,8-9,12-13,16-17H2,1-7H3,(H,28,29,30)/t19-,21?/m1/s1 |
| InChIKey | STYHVFHTURDIRV-YMBRHYMPSA-N |
| XLogP | 4.85 |
| TPSA | 114.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.70 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|