C25H37N3O4Si — CID 11554630
N-[(3R)-8-[tert-butyl(dimethyl)silyl]oxy-3-(dicyanomethyl)octanoyl]-2-methoxybenzamide (PubChem CID 11554630) has the molecular formula C25H37N3O4Si and a molecular weight of 471.67 g/mol. Its IUPAC name is N-[(3R)-8-[tert-butyl(dimethyl)silyl]oxy-3-(dicyanomethyl)octanoyl]-2-methoxybenzamide.
| Compound Name | N-[(3R)-8-[tert-butyl(dimethyl)silyl]oxy-3-(dicyanomethyl)octanoyl]-2-methoxybenzamide |
|---|---|
| PubChem CID | 11554630 |
| Molecular Formula | C25H37N3O4Si |
| Molecular Weight | 471.67 g/mol |
| Exact Mass | 471.26 |
| IUPAC Name | N-[(3R)-8-[tert-butyl(dimethyl)silyl]oxy-3-(dicyanomethyl)octanoyl]-2-methoxybenzamide |
| SMILES | COc1ccccc1C(=O)NC(=O)C[C@@H](CCCCCO[Si](C)(C)C(C)(C)C)C(C#N)C#N |
| InChI | InChI=1S/C25H37N3O4Si/c1-25(2,3)33(5,6)32-15-11-7-8-12-19(20(17-26)18-27)16-23(29)28-24(30)21-13-9-10-14-22(21)31-4/h9-10,13-14,19-20H,7-8,11-12,15-16H2,1-6H3,(H,28,29,30)/t19-/m1/s1 |
| InChIKey | NXCSUWYZDIKTBN-LJQANCHMSA-N |
| XLogP | 5.20 |
| TPSA | 112.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.67 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|