C17H16F2O3S — CID 102575334
ethyl 3,3-difluoro-2-hydroxy-2-phenyl-3-phenylsulfanylpropanoate (PubChem CID 102575334) has the molecular formula C17H16F2O3S and a molecular weight of 338.38 g/mol. Its IUPAC name is ethyl 3,3-difluoro-2-hydroxy-2-phenyl-3-phenylsulfanylpropanoate.
| Compound Name | ethyl 3,3-difluoro-2-hydroxy-2-phenyl-3-phenylsulfanylpropanoate |
|---|---|
| PubChem CID | 102575334 |
| Molecular Formula | C17H16F2O3S |
| Molecular Weight | 338.38 g/mol |
| Exact Mass | 338.08 |
| IUPAC Name | ethyl 3,3-difluoro-2-hydroxy-2-phenyl-3-phenylsulfanylpropanoate |
| SMILES | CCOC(=O)C(O)(c1ccccc1)C(F)(F)Sc1ccccc1 |
| InChI | InChI=1S/C17H16F2O3S/c1-2-22-15(20)16(21,13-9-5-3-6-10-13)17(18,19)23-14-11-7-4-8-12-14/h3-12,21H,2H2,1H3 |
| InChIKey | NUMJGQVGWXTVOW-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.38 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |