C22H21NO2 — CID 102575831
(1R,11S,15S)-17-benzyl-14-oxa-17-azatetracyclo[8.7.0.02,7.011,15]heptadeca-2,4,6,9-tetraen-13-one (PubChem CID 102575831) has the molecular formula C22H21NO2 and a molecular weight of 331.42 g/mol. Its IUPAC name is (1R,11S,15S)-17-benzyl-14-oxa-17-azatetracyclo[8.7.0.02,7.011,15]heptadeca-2,4,6,9-tetraen-13-one.
| Compound Name | (1R,11S,15S)-17-benzyl-14-oxa-17-azatetracyclo[8.7.0.02,7.011,15]heptadeca-2,4,6,9-tetraen-13-one |
|---|---|
| PubChem CID | 102575831 |
| Molecular Formula | C22H21NO2 |
| Molecular Weight | 331.42 g/mol |
| Exact Mass | 331.16 |
| IUPAC Name | (1R,11S,15S)-17-benzyl-14-oxa-17-azatetracyclo[8.7.0.02,7.011,15]heptadeca-2,4,6,9-tetraen-13-one |
| SMILES | O=C1C[C@H]2C3=CCc4ccccc4[C@@H]3N(Cc3ccccc3)C[C@H]2O1 |
| InChI | InChI=1S/C22H21NO2/c24-21-12-19-18-11-10-16-8-4-5-9-17(16)22(18)23(14-20(19)25-21)13-15-6-2-1-3-7-15/h1-9,11,19-20,22H,10,12-14H2/t19-,20+,22-/m0/s1 |
| InChIKey | ZZQZGZQTEQYBCO-VWPQPMDRSA-N |
| XLogP | 3.66 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.42 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|