C10H13NO5 — CID 102576630
methyl (1R,2S,3R,4S)-3-(methoxycarbonylamino)-7-oxabicyclo[2.2.1]hept-5-ene-2-carboxylate (PubChem CID 102576630) has the molecular formula C10H13NO5 and a molecular weight of 227.22 g/mol. Its IUPAC name is methyl (1R,2S,3R,4S)-3-(methoxycarbonylamino)-7-oxabicyclo[2.2.1]hept-5-ene-2-carboxylate.
| Compound Name | methyl (1R,2S,3R,4S)-3-(methoxycarbonylamino)-7-oxabicyclo[2.2.1]hept-5-ene-2-carboxylate |
|---|---|
| PubChem CID | 102576630 |
| Molecular Formula | C10H13NO5 |
| Molecular Weight | 227.22 g/mol |
| Exact Mass | 227.08 |
| IUPAC Name | methyl (1R,2S,3R,4S)-3-(methoxycarbonylamino)-7-oxabicyclo[2.2.1]hept-5-ene-2-carboxylate |
| SMILES | COC(=O)N[C@@H]1[C@H](C(=O)OC)[C@H]2C=C[C@@H]1O2 |
| InChI | InChI=1S/C10H13NO5/c1-14-9(12)7-5-3-4-6(16-5)8(7)11-10(13)15-2/h3-8H,1-2H3,(H,11,13)/t5-,6+,7-,8+/m1/s1 |
| InChIKey | FOSWXEDIJZRVRG-CWKFCGSDSA-N |
| XLogP | -0.16 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.22 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|