C24H26FIN2O6 — CID 10257668
5-fluoro-3-[[(2S)-2-[[2-(5-(125I)iodo-2-phenoxyphenyl)acetyl]amino]-3-methylbutanoyl]amino]-4-oxopentanoic acid (PubChem CID 10257668) has the molecular formula C24H26FIN2O6 and a molecular weight of 582.38 g/mol. Its IUPAC name is 5-fluoro-3-[[(2S)-2-[[2-(5-(125I)iodo-2-phenoxyphenyl)acetyl]amino]-3-methylbutanoyl]amino]-4-oxopentanoic acid.
| Compound Name | 5-fluoro-3-[[(2S)-2-[[2-(5-(125I)iodo-2-phenoxyphenyl)acetyl]amino]-3-methylbutanoyl]amino]-4-oxopentanoic acid |
|---|---|
| PubChem CID | 10257668 |
| Molecular Formula | C24H26FIN2O6 |
| Molecular Weight | 582.38 g/mol |
| Exact Mass | 582.08 |
| IUPAC Name | 5-fluoro-3-[[(2S)-2-[[2-(5-(125I)iodo-2-phenoxyphenyl)acetyl]amino]-3-methylbutanoyl]amino]-4-oxopentanoic acid |
| SMILES | CC(C)[C@H](NC(=O)Cc1cc([125I])ccc1Oc1ccccc1)C(=O)NC(CC(=O)O)C(=O)CF |
| InChI | InChI=1S/C24H26FIN2O6/c1-14(2)23(24(33)27-18(12-22(31)32)19(29)13-25)28-21(30)11-15-10-16(26)8-9-20(15)34-17-6-4-3-5-7-17/h3-10,14,18,23H,11-13H2,1-2H3,(H,27,33)(H,28,30)(H,31,32)/t18?,23-/m0/s1/i26-2 |
| InChIKey | FBPKJLZSLCEVJX-JWWWSAQMSA-N |
| XLogP | 3.26 |
| TPSA | 121.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.38 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|