C24H24F12NOSi+ — CID 102576854
[bis[3,5-bis(trifluoromethyl)phenyl]-[(2S)-pyrrolidin-1-ium-2-yl]methoxy]-trimethylsilane (PubChem CID 102576854) has the molecular formula C24H24F12NOSi+ and a molecular weight of 598.52 g/mol. Its IUPAC name is [bis[3,5-bis(trifluoromethyl)phenyl]-[(2S)-pyrrolidin-1-ium-2-yl]methoxy]-trimethylsilane.
| Compound Name | [bis[3,5-bis(trifluoromethyl)phenyl]-[(2S)-pyrrolidin-1-ium-2-yl]methoxy]-trimethylsilane |
|---|---|
| PubChem CID | 102576854 |
| Molecular Formula | C24H24F12NOSi+ |
| Molecular Weight | 598.52 g/mol |
| Exact Mass | 598.14 |
| IUPAC Name | [bis[3,5-bis(trifluoromethyl)phenyl]-[(2S)-pyrrolidin-1-ium-2-yl]methoxy]-trimethylsilane |
| SMILES | C[Si](C)(C)OC(c1cc(C(F)(F)F)cc(C(F)(F)F)c1)(c1cc(C(F)(F)F)cc(C(F)(F)F)c1)[C@@H]1CCC[NH2+]1 |
| InChI | InChI=1S/C24H23F12NOSi/c1-39(2,3)38-20(19-5-4-6-37-19,13-7-15(21(25,26)27)11-16(8-13)22(28,29)30)14-9-17(23(31,32)33)12-18(10-14)24(34,35)36/h7-12,19,37H,4-6H2,1-3H3/p+1/t19-/m0/s1 |
| InChIKey | MOHRGTBNEJKFMB-IBGZPJMESA-O |
| XLogP | 7.58 |
| TPSA | 25.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.52 |
| LogP ≤ 5 | 7.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|