C18H28N2O3S — CID 102579149
N-[5,5-dimethyl-1-(4-methylphenyl)sulfonylpiperidin-3-yl]butanamide (PubChem CID 102579149) has the molecular formula C18H28N2O3S and a molecular weight of 352.50 g/mol. Its IUPAC name is N-[5,5-dimethyl-1-(4-methylphenyl)sulfonylpiperidin-3-yl]butanamide.
| Compound Name | N-[5,5-dimethyl-1-(4-methylphenyl)sulfonylpiperidin-3-yl]butanamide |
|---|---|
| PubChem CID | 102579149 |
| Molecular Formula | C18H28N2O3S |
| Molecular Weight | 352.50 g/mol |
| Exact Mass | 352.18 |
| IUPAC Name | N-[5,5-dimethyl-1-(4-methylphenyl)sulfonylpiperidin-3-yl]butanamide |
| SMILES | CCCC(=O)NC1CN(S(=O)(=O)c2ccc(C)cc2)CC(C)(C)C1 |
| InChI | InChI=1S/C18H28N2O3S/c1-5-6-17(21)19-15-11-18(3,4)13-20(12-15)24(22,23)16-9-7-14(2)8-10-16/h7-10,15H,5-6,11-13H2,1-4H3,(H,19,21) |
| InChIKey | RJDUWMNVCKWUHH-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.50 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |