C13H20N2O3Si — CID 102579599
ethyl 6-methyl-2-oxo-4-(2-trimethylsilylethynyl)-3,4-dihydro-1H-pyrimidine-5-carboxylate (PubChem CID 102579599) has the molecular formula C13H20N2O3Si and a molecular weight of 280.40 g/mol. Its IUPAC name is ethyl 6-methyl-2-oxo-4-(2-trimethylsilylethynyl)-3,4-dihydro-1H-pyrimidine-5-carboxylate.
| Compound Name | ethyl 6-methyl-2-oxo-4-(2-trimethylsilylethynyl)-3,4-dihydro-1H-pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 102579599 |
| Molecular Formula | C13H20N2O3Si |
| Molecular Weight | 280.40 g/mol |
| Exact Mass | 280.12 |
| IUPAC Name | ethyl 6-methyl-2-oxo-4-(2-trimethylsilylethynyl)-3,4-dihydro-1H-pyrimidine-5-carboxylate |
| SMILES | CCOC(=O)C1=C(C)NC(=O)NC1C#C[Si](C)(C)C |
| InChI | InChI=1S/C13H20N2O3Si/c1-6-18-12(16)11-9(2)14-13(17)15-10(11)7-8-19(3,4)5/h10H,6H2,1-5H3,(H2,14,15,17) |
| InChIKey | TVCPCMOIRZIFDQ-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.40 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|