C19H22N2O4 — CID 102579600
ethyl 4-(3-hydroxy-3-phenylpent-1-ynyl)-6-methyl-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxylate (PubChem CID 102579600) has the molecular formula C19H22N2O4 and a molecular weight of 342.40 g/mol. Its IUPAC name is ethyl 4-(3-hydroxy-3-phenylpent-1-ynyl)-6-methyl-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxylate.
| Compound Name | ethyl 4-(3-hydroxy-3-phenylpent-1-ynyl)-6-methyl-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 102579600 |
| Molecular Formula | C19H22N2O4 |
| Molecular Weight | 342.40 g/mol |
| Exact Mass | 342.16 |
| IUPAC Name | ethyl 4-(3-hydroxy-3-phenylpent-1-ynyl)-6-methyl-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxylate |
| SMILES | CCOC(=O)C1=C(C)NC(=O)NC1C#CC(O)(CC)c1ccccc1 |
| InChI | InChI=1S/C19H22N2O4/c1-4-19(24,14-9-7-6-8-10-14)12-11-15-16(17(22)25-5-2)13(3)20-18(23)21-15/h6-10,15,24H,4-5H2,1-3H3,(H2,20,21,23) |
| InChIKey | KTIDMUIJSFWXEC-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.40 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|