C20H30O5 — CID 102580394
(3S,5R,8S,12S,13S,14S,16R)-8,14,16-trihydroxy-5,12,13,16-tetramethyl-9-methylidene-4-oxatricyclo[10.3.1.03,5]hexadec-1(15)-en-2-one (PubChem CID 102580394) has the molecular formula C20H30O5 and a molecular weight of 350.46 g/mol. Its IUPAC name is (3S,5R,8S,12S,13S,14S,16R)-8,14,16-trihydroxy-5,12,13,16-tetramethyl-9-methylidene-4-oxatricyclo[10.3.1.03,5]hexadec-1(15)-en-2-one.
| Compound Name | (3S,5R,8S,12S,13S,14S,16R)-8,14,16-trihydroxy-5,12,13,16-tetramethyl-9-methylidene-4-oxatricyclo[10.3.1.03,5]hexadec-1(15)-en-2-one |
|---|---|
| PubChem CID | 102580394 |
| Molecular Formula | C20H30O5 |
| Molecular Weight | 350.46 g/mol |
| Exact Mass | 350.21 |
| IUPAC Name | (3S,5R,8S,12S,13S,14S,16R)-8,14,16-trihydroxy-5,12,13,16-tetramethyl-9-methylidene-4-oxatricyclo[10.3.1.03,5]hexadec-1(15)-en-2-one |
| SMILES | C=C1CC[C@@]2(C)[C@H](C)[C@@H](O)C=C(C(=O)[C@H]3O[C@]3(C)CC[C@@H]1O)[C@]2(C)O |
| InChI | InChI=1S/C20H30O5/c1-11-6-8-18(3)12(2)15(22)10-13(20(18,5)24)16(23)17-19(4,25-17)9-7-14(11)21/h10,12,14-15,17,21-22,24H,1,6-9H2,2-5H3/t12-,14+,15+,17-,18+,19-,20+/m1/s1 |
| InChIKey | PHIPURFHHJFSRS-CQZAWUERSA-N |
| XLogP | 1.90 |
| TPSA | 90.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.46 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|