C21H23NO2S2 — CID 102583260
[1-(3-methoxyphenyl)-3-oxo-3-phenylpropyl] pyrrolidine-1-carbodithioate (PubChem CID 102583260) has the molecular formula C21H23NO2S2 and a molecular weight of 385.55 g/mol. Its IUPAC name is [1-(3-methoxyphenyl)-3-oxo-3-phenylpropyl] pyrrolidine-1-carbodithioate.
| Compound Name | [1-(3-methoxyphenyl)-3-oxo-3-phenylpropyl] pyrrolidine-1-carbodithioate |
|---|---|
| PubChem CID | 102583260 |
| Molecular Formula | C21H23NO2S2 |
| Molecular Weight | 385.55 g/mol |
| Exact Mass | 385.12 |
| IUPAC Name | [1-(3-methoxyphenyl)-3-oxo-3-phenylpropyl] pyrrolidine-1-carbodithioate |
| SMILES | COc1cccc(C(CC(=O)c2ccccc2)SC(=S)N2CCCC2)c1 |
| InChI | InChI=1S/C21H23NO2S2/c1-24-18-11-7-10-17(14-18)20(26-21(25)22-12-5-6-13-22)15-19(23)16-8-3-2-4-9-16/h2-4,7-11,14,20H,5-6,12-13,15H2,1H3 |
| InChIKey | OJZGHBALABQVAO-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.55 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|