C17H22N2O4S2 — CID 102292569
[[(2S,3S)-1-methoxy-1-oxo-3-(pyrrolidine-1-carbothioylsulfanyl)butan-2-yl]amino] benzoate (PubChem CID 102292569) has the molecular formula C17H22N2O4S2 and a molecular weight of 382.51 g/mol. Its IUPAC name is [[(2S,3S)-1-methoxy-1-oxo-3-(pyrrolidine-1-carbothioylsulfanyl)butan-2-yl]amino] benzoate.
| Compound Name | [[(2S,3S)-1-methoxy-1-oxo-3-(pyrrolidine-1-carbothioylsulfanyl)butan-2-yl]amino] benzoate |
|---|---|
| PubChem CID | 102292569 |
| Molecular Formula | C17H22N2O4S2 |
| Molecular Weight | 382.51 g/mol |
| Exact Mass | 382.10 |
| IUPAC Name | [[(2S,3S)-1-methoxy-1-oxo-3-(pyrrolidine-1-carbothioylsulfanyl)butan-2-yl]amino] benzoate |
| SMILES | COC(=O)[C@H](NOC(=O)c1ccccc1)[C@H](C)SC(=S)N1CCCC1 |
| InChI | InChI=1S/C17H22N2O4S2/c1-12(25-17(24)19-10-6-7-11-19)14(16(21)22-2)18-23-15(20)13-8-4-3-5-9-13/h3-5,8-9,12,14,18H,6-7,10-11H2,1-2H3/t12-,14+/m0/s1 |
| InChIKey | ULWNMSZKQKCBOC-GXTWGEPZSA-N |
| XLogP | 2.39 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.51 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|