C22H34N4O3 — CID 102583756
1-[2-[bis[(4-methoxy-3,5-dimethyl-2-pyridinyl)methyl]amino]ethylamino]ethanol (PubChem CID 102583756) has the molecular formula C22H34N4O3 and a molecular weight of 402.54 g/mol. Its IUPAC name is 1-[2-[bis[(4-methoxy-3,5-dimethyl-2-pyridinyl)methyl]amino]ethylamino]ethanol.
| Compound Name | 1-[2-[bis[(4-methoxy-3,5-dimethyl-2-pyridinyl)methyl]amino]ethylamino]ethanol |
|---|---|
| PubChem CID | 102583756 |
| Molecular Formula | C22H34N4O3 |
| Molecular Weight | 402.54 g/mol |
| Exact Mass | 402.26 |
| IUPAC Name | 1-[2-[bis[(4-methoxy-3,5-dimethyl-2-pyridinyl)methyl]amino]ethylamino]ethanol |
| SMILES | COc1c(C)cnc(CN(CCNC(C)O)Cc2ncc(C)c(OC)c2C)c1C |
| InChI | InChI=1S/C22H34N4O3/c1-14-10-24-19(16(3)21(14)28-6)12-26(9-8-23-18(5)27)13-20-17(4)22(29-7)15(2)11-25-20/h10-11,18,23,27H,8-9,12-13H2,1-7H3 |
| InChIKey | IXUAXJACCJCWSK-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 79.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.54 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|