C13H22N4O2 — CID 76928126
N'-hydroxy-2-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methyl-methylamino]propanimidamide (PubChem CID 76928126) has the molecular formula C13H22N4O2 and a molecular weight of 266.34 g/mol. Its IUPAC name is N'-hydroxy-2-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methyl-methylamino]propanimidamide.
| Compound Name | N'-hydroxy-2-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methyl-methylamino]propanimidamide |
|---|---|
| PubChem CID | 76928126 |
| Molecular Formula | C13H22N4O2 |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.17 |
| IUPAC Name | N'-hydroxy-2-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methyl-methylamino]propanimidamide |
| SMILES | COc1c(C)cnc(CN(C)C(C)C(N)=NO)c1C |
| InChI | InChI=1S/C13H22N4O2/c1-8-6-15-11(9(2)12(8)19-5)7-17(4)10(3)13(14)16-18/h6,10,18H,7H2,1-5H3,(H2,14,16) |
| InChIKey | DNCVDDNSHSOMPE-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 83.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|