About (2R)-N-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methyl]-N,2-dimethylpentanamide
(2R)-N-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methyl]-N,2-dimethylpentanamide (PubChem CID 95316113) has the molecular formula C16H26N2O2
and a molecular weight of 278.40 g/mol. Its IUPAC name is (2R)-N-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methyl]-N,2-dimethylpentanamide.
Molecular Properties
| Compound Name | (2R)-N-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methyl]-N,2-dimethylpentanamide |
| PubChem CID | 95316113 |
| Molecular Formula | C16H26N2O2 |
| Molecular Weight | 278.40 g/mol |
| Exact Mass | 278.20 |
| IUPAC Name | (2R)-N-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methyl]-N,2-dimethylpentanamide |
| SMILES | CCC[C@@H](C)C(=O)N(C)Cc1ncc(C)c(OC)c1C |
| InChI | InChI=1S/C16H26N2O2/c1-7-8-11(2)16(19)18(5)10-14-13(4)15(20-6)12(3)9-17-14/h9,11H,7-8,10H2,1-6H3/t11-/m1/s1 |
| InChIKey | SIBVEFDANLIHFA-LLVKDONJSA-N |
| XLogP | 3.10 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.40 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2R)-N-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methyl]-N,2-dimethylpentanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-N-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methyl]-N,2-dimethylpentanamide?
The IUPAC name of (2R)-N-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methyl]-N,2-dimethylpentanamide (CID 95316113) is (2R)-N-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methyl]-N,2-dimethylpentanamide.
What is the SMILES notation for (2R)-N-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methyl]-N,2-dimethylpentanamide?
The canonical SMILES for (2R)-N-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methyl]-N,2-dimethylpentanamide is CCC[C@@H](C)C(=O)N(C)Cc1ncc(C)c(OC)c1C.
What is the InChIKey of (2R)-N-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methyl]-N,2-dimethylpentanamide?
The InChIKey is SIBVEFDANLIHFA-LLVKDONJSA-N. The full InChI is InChI=1S/C16H26N2O2/c1-7-8-11(2)16(19)18(5)10-14-13(4)15(20-6)12(3)9-17-14/h9,11H,7-8,10H2,1-6H3/t11-/m1/s1.
What are the key properties of (2R)-N-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methyl]-N,2-dimethylpentanamide?
(2R)-N-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methyl]-N,2-dimethylpentanamide has a molecular weight of 278.40 g/mol, XLogP of 3.10, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-N-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methyl]-N,2-dimethylpentanamide is sourced from PubChem (CID 95316113), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).