About (2R)-N-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methyl]-2-methylpentanamide
(2R)-N-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methyl]-2-methylpentanamide (PubChem CID 95315582) has the molecular formula C15H24N2O2
and a molecular weight of 264.37 g/mol. Its IUPAC name is (2R)-N-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methyl]-2-methylpentanamide.
Molecular Properties
| Compound Name | (2R)-N-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methyl]-2-methylpentanamide |
| PubChem CID | 95315582 |
| Molecular Formula | C15H24N2O2 |
| Molecular Weight | 264.37 g/mol |
| Exact Mass | 264.18 |
| IUPAC Name | (2R)-N-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methyl]-2-methylpentanamide |
| SMILES | CCC[C@@H](C)C(=O)NCc1ncc(C)c(OC)c1C |
| InChI | InChI=1S/C15H24N2O2/c1-6-7-10(2)15(18)17-9-13-12(4)14(19-5)11(3)8-16-13/h8,10H,6-7,9H2,1-5H3,(H,17,18)/t10-/m1/s1 |
| InChIKey | RXVNEZLZPJXJOG-SNVBAGLBSA-N |
| XLogP | 2.76 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.37 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2R)-N-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methyl]-2-methylpentanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-N-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methyl]-2-methylpentanamide?
The IUPAC name of (2R)-N-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methyl]-2-methylpentanamide (CID 95315582) is (2R)-N-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methyl]-2-methylpentanamide.
What is the SMILES notation for (2R)-N-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methyl]-2-methylpentanamide?
The canonical SMILES for (2R)-N-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methyl]-2-methylpentanamide is CCC[C@@H](C)C(=O)NCc1ncc(C)c(OC)c1C.
What is the InChIKey of (2R)-N-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methyl]-2-methylpentanamide?
The InChIKey is RXVNEZLZPJXJOG-SNVBAGLBSA-N. The full InChI is InChI=1S/C15H24N2O2/c1-6-7-10(2)15(18)17-9-13-12(4)14(19-5)11(3)8-16-13/h8,10H,6-7,9H2,1-5H3,(H,17,18)/t10-/m1/s1.
What are the key properties of (2R)-N-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methyl]-2-methylpentanamide?
(2R)-N-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methyl]-2-methylpentanamide has a molecular weight of 264.37 g/mol, XLogP of 2.76, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-N-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methyl]-2-methylpentanamide is sourced from PubChem (CID 95315582), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).