C13H20O2S — CID 102585866
2-[(4-methylphenyl)methylsulfanylmethyl]butane-1,4-diol (PubChem CID 102585866) has the molecular formula C13H20O2S and a molecular weight of 240.37 g/mol. Its IUPAC name is 2-[(4-methylphenyl)methylsulfanylmethyl]butane-1,4-diol.
| Compound Name | 2-[(4-methylphenyl)methylsulfanylmethyl]butane-1,4-diol |
|---|---|
| PubChem CID | 102585866 |
| Molecular Formula | C13H20O2S |
| Molecular Weight | 240.37 g/mol |
| Exact Mass | 240.12 |
| IUPAC Name | 2-[(4-methylphenyl)methylsulfanylmethyl]butane-1,4-diol |
| SMILES | Cc1ccc(CSCC(CO)CCO)cc1 |
| InChI | InChI=1S/C13H20O2S/c1-11-2-4-12(5-3-11)9-16-10-13(8-15)6-7-14/h2-5,13-15H,6-10H2,1H3 |
| InChIKey | ALLAMHFGZIDTAG-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.37 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |