C20H32O5 — CID 102586902
(1S,2R,5R,7R,8R,9S,10R,12R,15R)-5-(3-hydroxyprop-1-en-2-yl)-11,11-dimethyl-13-oxatetracyclo[10.2.2.01,10.02,7]hexadecane-8,9,15-triol (PubChem CID 102586902) has the molecular formula C20H32O5 and a molecular weight of 352.47 g/mol. Its IUPAC name is (1S,2R,5R,7R,8R,9S,10R,12R,15R)-5-(3-hydroxyprop-1-en-2-yl)-11,11-dimethyl-13-oxatetracyclo[10.2.2.01,10.02,7]hexadecane-8,9,15-triol.
| Compound Name | (1S,2R,5R,7R,8R,9S,10R,12R,15R)-5-(3-hydroxyprop-1-en-2-yl)-11,11-dimethyl-13-oxatetracyclo[10.2.2.01,10.02,7]hexadecane-8,9,15-triol |
|---|---|
| PubChem CID | 102586902 |
| Molecular Formula | C20H32O5 |
| Molecular Weight | 352.47 g/mol |
| Exact Mass | 352.22 |
| IUPAC Name | (1S,2R,5R,7R,8R,9S,10R,12R,15R)-5-(3-hydroxyprop-1-en-2-yl)-11,11-dimethyl-13-oxatetracyclo[10.2.2.01,10.02,7]hexadecane-8,9,15-triol |
| SMILES | C=C(CO)[C@@H]1CC[C@@H]2[C@@H](C1)[C@@H](O)[C@@H](O)[C@@H]1C(C)(C)[C@H]3C[C@@H](O)[C@@]21CO3 |
| InChI | InChI=1S/C20H32O5/c1-10(8-21)11-4-5-13-12(6-11)16(23)17(24)18-19(2,3)15-7-14(22)20(13,18)9-25-15/h11-18,21-24H,1,4-9H2,2-3H3/t11-,12-,13-,14-,15-,16-,17-,18-,20-/m1/s1 |
| InChIKey | JKPDVGJXXDUODE-QVWVHOKLSA-N |
| XLogP | 1.10 |
| TPSA | 90.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.47 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|