C14H22O3 — CID 163358966
(1S,3R,5R,6R,8R,9R,10S)-3-(3-hydroxyprop-1-en-2-yl)-10-methyltricyclo[4.4.0.01,5]decane-8,9-diol (PubChem CID 163358966) has the molecular formula C14H22O3 and a molecular weight of 238.33 g/mol. Its IUPAC name is (1S,3R,5R,6R,8R,9R,10S)-3-(3-hydroxyprop-1-en-2-yl)-10-methyltricyclo[4.4.0.01,5]decane-8,9-diol.
| Compound Name | (1S,3R,5R,6R,8R,9R,10S)-3-(3-hydroxyprop-1-en-2-yl)-10-methyltricyclo[4.4.0.01,5]decane-8,9-diol |
|---|---|
| PubChem CID | 163358966 |
| Molecular Formula | C14H22O3 |
| Molecular Weight | 238.33 g/mol |
| Exact Mass | 238.16 |
| IUPAC Name | (1S,3R,5R,6R,8R,9R,10S)-3-(3-hydroxyprop-1-en-2-yl)-10-methyltricyclo[4.4.0.01,5]decane-8,9-diol |
| SMILES | C=C(CO)[C@@H]1C[C@@H]2[C@H]3C[C@@H](O)[C@H](O)[C@@H](C)[C@@]23C1 |
| InChI | InChI=1S/C14H22O3/c1-7(6-15)9-3-10-11-4-12(16)13(17)8(2)14(10,11)5-9/h8-13,15-17H,1,3-6H2,2H3/t8-,9-,10-,11-,12-,13-,14+/m1/s1 |
| InChIKey | AIZWGRSMWNJPSB-UAZQNFISSA-N |
| XLogP | 0.94 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.33 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|