C16H22O2Se — CID 10592118
(4R)-4-(3-hydroxyprop-1-en-2-yl)-1-methyl-2-phenylselanylcyclohexan-1-ol (PubChem CID 10592118) has the molecular formula C16H22O2Se and a molecular weight of 325.31 g/mol. Its IUPAC name is (4R)-4-(3-hydroxyprop-1-en-2-yl)-1-methyl-2-phenylselanylcyclohexan-1-ol.
| Compound Name | (4R)-4-(3-hydroxyprop-1-en-2-yl)-1-methyl-2-phenylselanylcyclohexan-1-ol |
|---|---|
| PubChem CID | 10592118 |
| Molecular Formula | C16H22O2Se |
| Molecular Weight | 325.31 g/mol |
| Exact Mass | 326.08 |
| IUPAC Name | (4R)-4-(3-hydroxyprop-1-en-2-yl)-1-methyl-2-phenylselanylcyclohexan-1-ol |
| SMILES | C=C(CO)[C@@H]1CCC(C)(O)C([Se]c2ccccc2)C1 |
| InChI | InChI=1S/C16H22O2Se/c1-12(11-17)13-8-9-16(2,18)15(10-13)19-14-6-4-3-5-7-14/h3-7,13,15,17-18H,1,8-11H2,2H3/t13-,15?,16?/m1/s1 |
| InChIKey | CHQCTLDUXZYZBE-IUDNXUCKSA-N |
| XLogP | 1.90 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.31 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|