C18H27NO — CID 70163697
(1S,2S,4R)-1-methyl-2-[[(1R)-1-phenylethyl]amino]-4-prop-1-en-2-ylcyclohexan-1-ol (PubChem CID 70163697) has the molecular formula C18H27NO and a molecular weight of 273.42 g/mol. Its IUPAC name is (1S,2S,4R)-1-methyl-2-[[(1R)-1-phenylethyl]amino]-4-prop-1-en-2-ylcyclohexan-1-ol.
| Compound Name | (1S,2S,4R)-1-methyl-2-[[(1R)-1-phenylethyl]amino]-4-prop-1-en-2-ylcyclohexan-1-ol |
|---|---|
| PubChem CID | 70163697 |
| Molecular Formula | C18H27NO |
| Molecular Weight | 273.42 g/mol |
| Exact Mass | 273.21 |
| IUPAC Name | (1S,2S,4R)-1-methyl-2-[[(1R)-1-phenylethyl]amino]-4-prop-1-en-2-ylcyclohexan-1-ol |
| SMILES | C=C(C)[C@@H]1CC[C@](C)(O)[C@@H](N[C@H](C)c2ccccc2)C1 |
| InChI | InChI=1S/C18H27NO/c1-13(2)16-10-11-18(4,20)17(12-16)19-14(3)15-8-6-5-7-9-15/h5-9,14,16-17,19-20H,1,10-12H2,2-4H3/t14-,16-,17+,18+/m1/s1 |
| InChIKey | XBXMRLCLTQOECP-BGTYHANMSA-N |
| XLogP | 3.83 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.42 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|