About methyl 1'-benzyl-2'-oxospiro[1,2-dihydroindene-3,5'-piperidine]-5-carboxylate
methyl 1'-benzyl-2'-oxospiro[1,2-dihydroindene-3,5'-piperidine]-5-carboxylate (PubChem CID 102589037) has the molecular formula C22H23NO3
and a molecular weight of 349.43 g/mol. Its IUPAC name is methyl 1'-benzyl-2'-oxospiro[1,2-dihydroindene-3,5'-piperidine]-5-carboxylate.
Molecular Properties
| Compound Name | methyl 1'-benzyl-2'-oxospiro[1,2-dihydroindene-3,5'-piperidine]-5-carboxylate |
| PubChem CID | 102589037 |
| Molecular Formula | C22H23NO3 |
| Molecular Weight | 349.43 g/mol |
| Exact Mass | 349.17 |
| IUPAC Name | methyl 1'-benzyl-2'-oxospiro[1,2-dihydroindene-3,5'-piperidine]-5-carboxylate |
| SMILES | COC(=O)c1ccc2c(c1)C1(CCC(=O)N(Cc3ccccc3)C1)CC2 |
| InChI | InChI=1S/C22H23NO3/c1-26-21(25)18-8-7-17-9-11-22(19(17)13-18)12-10-20(24)23(15-22)14-16-5-3-2-4-6-16/h2-8,13H,9-12,14-15H2,1H3 |
| InChIKey | VINDOZCJSBUZIC-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 349.43 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze methyl 1'-benzyl-2'-oxospiro[1,2-dihydroindene-3,5'-piperidine]-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 1'-benzyl-2'-oxospiro[1,2-dihydroindene-3,5'-piperidine]-5-carboxylate?
The IUPAC name of methyl 1'-benzyl-2'-oxospiro[1,2-dihydroindene-3,5'-piperidine]-5-carboxylate (CID 102589037) is methyl 1'-benzyl-2'-oxospiro[1,2-dihydroindene-3,5'-piperidine]-5-carboxylate.
What is the SMILES notation for methyl 1'-benzyl-2'-oxospiro[1,2-dihydroindene-3,5'-piperidine]-5-carboxylate?
The canonical SMILES for methyl 1'-benzyl-2'-oxospiro[1,2-dihydroindene-3,5'-piperidine]-5-carboxylate is COC(=O)c1ccc2c(c1)C1(CCC(=O)N(Cc3ccccc3)C1)CC2.
What is the InChIKey of methyl 1'-benzyl-2'-oxospiro[1,2-dihydroindene-3,5'-piperidine]-5-carboxylate?
The InChIKey is VINDOZCJSBUZIC-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H23NO3/c1-26-21(25)18-8-7-17-9-11-22(19(17)13-18)12-10-20(24)23(15-22)14-16-5-3-2-4-6-16/h2-8,13H,9-12,14-15H2,1H3.
What are the key properties of methyl 1'-benzyl-2'-oxospiro[1,2-dihydroindene-3,5'-piperidine]-5-carboxylate?
methyl 1'-benzyl-2'-oxospiro[1,2-dihydroindene-3,5'-piperidine]-5-carboxylate has a molecular weight of 349.43 g/mol, XLogP of 3.48, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 1'-benzyl-2'-oxospiro[1,2-dihydroindene-3,5'-piperidine]-5-carboxylate is sourced from PubChem (CID 102589037), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).