C16H25NO3 — CID 102589554
ethyl (2S)-4-methyl-5-oxo-1-pent-4-enyl-2-prop-2-enylpyrrolidine-2-carboxylate (PubChem CID 102589554) has the molecular formula C16H25NO3 and a molecular weight of 279.38 g/mol. Its IUPAC name is ethyl (2S)-4-methyl-5-oxo-1-pent-4-enyl-2-prop-2-enylpyrrolidine-2-carboxylate.
| Compound Name | ethyl (2S)-4-methyl-5-oxo-1-pent-4-enyl-2-prop-2-enylpyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 102589554 |
| Molecular Formula | C16H25NO3 |
| Molecular Weight | 279.38 g/mol |
| Exact Mass | 279.18 |
| IUPAC Name | ethyl (2S)-4-methyl-5-oxo-1-pent-4-enyl-2-prop-2-enylpyrrolidine-2-carboxylate |
| SMILES | C=CCCCN1C(=O)C(C)C[C@@]1(CC=C)C(=O)OCC |
| InChI | InChI=1S/C16H25NO3/c1-5-8-9-11-17-14(18)13(4)12-16(17,10-6-2)15(19)20-7-3/h5-6,13H,1-2,7-12H2,3-4H3/t13?,16-/m0/s1 |
| InChIKey | MPLZSLDOUWFFGC-VYIIXAMBSA-N |
| XLogP | 2.70 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.38 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|