C12H18O — CID 102592779
4a-ethenyl-2,3,4,5,6,7,8,8a-octahydronaphthalen-1-one (PubChem CID 102592779) has the molecular formula C12H18O and a molecular weight of 178.28 g/mol. Its IUPAC name is 4a-ethenyl-2,3,4,5,6,7,8,8a-octahydronaphthalen-1-one.
| Compound Name | 4a-ethenyl-2,3,4,5,6,7,8,8a-octahydronaphthalen-1-one |
|---|---|
| PubChem CID | 102592779 |
| Molecular Formula | C12H18O |
| Molecular Weight | 178.28 g/mol |
| Exact Mass | 178.14 |
| IUPAC Name | 4a-ethenyl-2,3,4,5,6,7,8,8a-octahydronaphthalen-1-one |
| SMILES | C=CC12CCCCC1C(=O)CCC2 |
| InChI | InChI=1S/C12H18O/c1-2-12-8-4-3-6-10(12)11(13)7-5-9-12/h2,10H,1,3-9H2 |
| InChIKey | BAUWCSHTCHZYOS-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.28 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|