C12H8Cl3F2N3O — CID 102593293
2,2,2-trichloro-1-[1-[(2,6-difluorophenyl)methyl]-5-methyltriazol-4-yl]ethanone (PubChem CID 102593293) has the molecular formula C12H8Cl3F2N3O and a molecular weight of 354.57 g/mol. Its IUPAC name is 2,2,2-trichloro-1-[1-[(2,6-difluorophenyl)methyl]-5-methyltriazol-4-yl]ethanone.
| Compound Name | 2,2,2-trichloro-1-[1-[(2,6-difluorophenyl)methyl]-5-methyltriazol-4-yl]ethanone |
|---|---|
| PubChem CID | 102593293 |
| Molecular Formula | C12H8Cl3F2N3O |
| Molecular Weight | 354.57 g/mol |
| Exact Mass | 352.97 |
| IUPAC Name | 2,2,2-trichloro-1-[1-[(2,6-difluorophenyl)methyl]-5-methyltriazol-4-yl]ethanone |
| SMILES | Cc1c(C(=O)C(Cl)(Cl)Cl)nnn1Cc1c(F)cccc1F |
| InChI | InChI=1S/C12H8Cl3F2N3O/c1-6-10(11(21)12(13,14)15)18-19-20(6)5-7-8(16)3-2-4-9(7)17/h2-4H,5H2,1H3 |
| InChIKey | DAMHMUKVIVEISX-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.57 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|