C10H18O4 — CID 102593602
(3R,4R,5R)-5-[(1S)-1-(methoxymethoxy)ethyl]-3,4-dimethyloxolan-2-one (PubChem CID 102593602) has the molecular formula C10H18O4 and a molecular weight of 202.25 g/mol. Its IUPAC name is (3R,4R,5R)-5-[(1S)-1-(methoxymethoxy)ethyl]-3,4-dimethyloxolan-2-one.
| Compound Name | (3R,4R,5R)-5-[(1S)-1-(methoxymethoxy)ethyl]-3,4-dimethyloxolan-2-one |
|---|---|
| PubChem CID | 102593602 |
| Molecular Formula | C10H18O4 |
| Molecular Weight | 202.25 g/mol |
| Exact Mass | 202.12 |
| IUPAC Name | (3R,4R,5R)-5-[(1S)-1-(methoxymethoxy)ethyl]-3,4-dimethyloxolan-2-one |
| SMILES | COCO[C@@H](C)[C@@H]1OC(=O)[C@H](C)[C@H]1C |
| InChI | InChI=1S/C10H18O4/c1-6-7(2)10(11)14-9(6)8(3)13-5-12-4/h6-9H,5H2,1-4H3/t6-,7-,8+,9-/m1/s1 |
| InChIKey | GREQQOLKJAEKMJ-LURQLKTLSA-N |
| XLogP | 1.19 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.25 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|