C10H18O5 — CID 146018101
(4S,5S)-5-(2-methoxyethoxymethoxymethyl)-4-methyloxolan-2-one (PubChem CID 146018101) has the molecular formula C10H18O5 and a molecular weight of 218.25 g/mol. Its IUPAC name is (4S,5S)-5-(2-methoxyethoxymethoxymethyl)-4-methyloxolan-2-one.
| Compound Name | (4S,5S)-5-(2-methoxyethoxymethoxymethyl)-4-methyloxolan-2-one |
|---|---|
| PubChem CID | 146018101 |
| Molecular Formula | C10H18O5 |
| Molecular Weight | 218.25 g/mol |
| Exact Mass | 218.12 |
| IUPAC Name | (4S,5S)-5-(2-methoxyethoxymethoxymethyl)-4-methyloxolan-2-one |
| SMILES | COCCOCOC[C@H]1OC(=O)C[C@@H]1C |
| InChI | InChI=1S/C10H18O5/c1-8-5-10(11)15-9(8)6-14-7-13-4-3-12-2/h8-9H,3-7H2,1-2H3/t8-,9+/m0/s1 |
| InChIKey | HESKCYQPMIYCQI-DTWKUNHWSA-N |
| XLogP | 0.58 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.25 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|