C11H17F2O4Os — CID 145498050
ethyl 3-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-difluorobutanoate;osmium(1+) (PubChem CID 145498050) has the molecular formula C11H17F2O4Os and a molecular weight of 441.48 g/mol. Its IUPAC name is ethyl 3-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-difluorobutanoate;osmium(1+).
| Compound Name | ethyl 3-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-difluorobutanoate;osmium(1+) |
|---|---|
| PubChem CID | 145498050 |
| Molecular Formula | C11H17F2O4Os |
| Molecular Weight | 441.48 g/mol |
| Exact Mass | 443.07 |
| IUPAC Name | ethyl 3-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-difluorobutanoate;osmium(1+) |
| SMILES | [CH2-]C([C@H]1COC(C)(C)O1)C(F)(F)C(=O)OCC.[Os+] |
| InChI | InChI=1S/C11H17F2O4.Os/c1-5-15-9(14)11(12,13)7(2)8-6-16-10(3,4)17-8;/h7-8H,2,5-6H2,1,3-4H3;/q-1;+1/t7?,8-;/m1./s1 |
| InChIKey | GQWFPJHVKKYITF-LTTWWRRRSA-N |
| XLogP | 1.78 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.48 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|