C36H43N3O8 — CID 102593747
2-[(1R,2R,5R,6R,8S,11R,12R)-12-methyl-6-[(4-nitrobenzoyl)oxymethyl]-14-azapentacyclo[10.3.3.15,8.01,11.02,8]nonadecan-14-yl]ethyl 4-nitrobenzoate (PubChem CID 102593747) has the molecular formula C36H43N3O8 and a molecular weight of 645.75 g/mol. Its IUPAC name is 2-[(1R,2R,5R,6R,8S,11R,12R)-12-methyl-6-[(4-nitrobenzoyl)oxymethyl]-14-azapentacyclo[10.3.3.15,8.01,11.02,8]nonadecan-14-yl]ethyl 4-nitrobenzoate.
| Compound Name | 2-[(1R,2R,5R,6R,8S,11R,12R)-12-methyl-6-[(4-nitrobenzoyl)oxymethyl]-14-azapentacyclo[10.3.3.15,8.01,11.02,8]nonadecan-14-yl]ethyl 4-nitrobenzoate |
|---|---|
| PubChem CID | 102593747 |
| Molecular Formula | C36H43N3O8 |
| Molecular Weight | 645.75 g/mol |
| Exact Mass | 645.31 |
| IUPAC Name | 2-[(1R,2R,5R,6R,8S,11R,12R)-12-methyl-6-[(4-nitrobenzoyl)oxymethyl]-14-azapentacyclo[10.3.3.15,8.01,11.02,8]nonadecan-14-yl]ethyl 4-nitrobenzoate |
| SMILES | C[C@]12CCC[C@]3(CN(CCOC(=O)c4ccc([N+](=O)[O-])cc4)C1)[C@@H]2CC[C@@]12C[C@@H](CC[C@H]13)[C@H](COC(=O)c1ccc([N+](=O)[O-])cc1)C2 |
| InChI | InChI=1S/C36H43N3O8/c1-34-14-2-15-36(23-37(22-34)17-18-46-32(40)24-3-8-28(9-4-24)38(42)43)30(34)13-16-35-19-26(7-12-31(35)36)27(20-35)21-47-33(41)25-5-10-29(11-6-25)39(44)45/h3-6,8-11,26-27,30-31H,2,7,12-23H2,1H3/t26-,27+,30-,31-,34+,35+,36+/m1/s1 |
| InChIKey | NTTVJELKUWFMIZ-HPYHUSKDSA-N |
| XLogP | 6.84 |
| TPSA | 142.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.75 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|