C18H21NO6 — CID 13006590
2-[(1S,4R,5R)-1,7,7-trimethyl-3-oxo-2-oxabicyclo[3.2.0]heptan-4-yl]ethyl 4-nitrobenzoate (PubChem CID 13006590) has the molecular formula C18H21NO6 and a molecular weight of 347.37 g/mol. Its IUPAC name is 2-[(1S,4R,5R)-1,7,7-trimethyl-3-oxo-2-oxabicyclo[3.2.0]heptan-4-yl]ethyl 4-nitrobenzoate.
| Compound Name | 2-[(1S,4R,5R)-1,7,7-trimethyl-3-oxo-2-oxabicyclo[3.2.0]heptan-4-yl]ethyl 4-nitrobenzoate |
|---|---|
| PubChem CID | 13006590 |
| Molecular Formula | C18H21NO6 |
| Molecular Weight | 347.37 g/mol |
| Exact Mass | 347.14 |
| IUPAC Name | 2-[(1S,4R,5R)-1,7,7-trimethyl-3-oxo-2-oxabicyclo[3.2.0]heptan-4-yl]ethyl 4-nitrobenzoate |
| SMILES | CC1(C)C[C@@H]2[C@@H](CCOC(=O)c3ccc([N+](=O)[O-])cc3)C(=O)O[C@@]21C |
| InChI | InChI=1S/C18H21NO6/c1-17(2)10-14-13(16(21)25-18(14,17)3)8-9-24-15(20)11-4-6-12(7-5-11)19(22)23/h4-7,13-14H,8-10H2,1-3H3/t13-,14-,18+/m1/s1 |
| InChIKey | WHVCYUVRYFSDSZ-LBTNJELSSA-N |
| XLogP | 3.12 |
| TPSA | 95.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.37 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|