C16H17NO5 — CID 134886707
2-(4-methoxycyclohexa-2,4-dien-1-yl)ethyl 4-nitrobenzoate (PubChem CID 134886707) has the molecular formula C16H17NO5 and a molecular weight of 303.31 g/mol. Its IUPAC name is 2-(4-methoxycyclohexa-2,4-dien-1-yl)ethyl 4-nitrobenzoate.
| Compound Name | 2-(4-methoxycyclohexa-2,4-dien-1-yl)ethyl 4-nitrobenzoate |
|---|---|
| PubChem CID | 134886707 |
| Molecular Formula | C16H17NO5 |
| Molecular Weight | 303.31 g/mol |
| Exact Mass | 303.11 |
| IUPAC Name | 2-(4-methoxycyclohexa-2,4-dien-1-yl)ethyl 4-nitrobenzoate |
| SMILES | COC1=CCC(CCOC(=O)c2ccc([N+](=O)[O-])cc2)C=C1 |
| InChI | InChI=1S/C16H17NO5/c1-21-15-8-2-12(3-9-15)10-11-22-16(18)13-4-6-14(7-5-13)17(19)20/h2,4-9,12H,3,10-11H2,1H3 |
| InChIKey | VNUONYOREBPQIB-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 78.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.31 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|