C45H39N6S3+3 — CID 102593839
2,4,6-tris[4-[(E)-2-(4-methylsulfanylphenyl)ethenyl]pyridin-1-ium-1-yl]-1,3,5-triazine (PubChem CID 102593839) has the molecular formula C45H39N6S3+3 and a molecular weight of 760.05 g/mol. Its IUPAC name is 2,4,6-tris[4-[(E)-2-(4-methylsulfanylphenyl)ethenyl]pyridin-1-ium-1-yl]-1,3,5-triazine.
| Compound Name | 2,4,6-tris[4-[(E)-2-(4-methylsulfanylphenyl)ethenyl]pyridin-1-ium-1-yl]-1,3,5-triazine |
|---|---|
| PubChem CID | 102593839 |
| Molecular Formula | C45H39N6S3+3 |
| Molecular Weight | 760.05 g/mol |
| Exact Mass | 759.24 |
| IUPAC Name | 2,4,6-tris[4-[(E)-2-(4-methylsulfanylphenyl)ethenyl]pyridin-1-ium-1-yl]-1,3,5-triazine |
| SMILES | CSc1ccc(/C=C/c2cc[n+](-c3nc(-[n+]4ccc(/C=C/c5ccc(SC)cc5)cc4)nc(-[n+]4ccc(/C=C/c5ccc(SC)cc5)cc4)n3)cc2)cc1 |
| InChI | InChI=1S/C45H39N6S3/c1-52-40-16-10-34(11-17-40)4-7-37-22-28-49(29-23-37)43-46-44(50-30-24-38(25-31-50)8-5-35-12-18-41(53-2)19-13-35)48-45(47-43)51-32-26-39(27-33-51)9-6-36-14-20-42(54-3)21-15-36/h4-33H,1-3H3/q+3/b7-4+,8-5+,9-6+ |
| InChIKey | XUZBJOSEIDTWFM-OTWDQPKHSA-N |
| XLogP | 9.38 |
| TPSA | 50.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 760.05 |
| LogP ≤ 5 | 9.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|