C24H41IO6Si — CID 102595989
[(E,1R)-1-[(1R,3S,4R,5S)-4-[(1S)-1-[tert-butyl(dimethyl)silyl]oxy-2-oxoethyl]-3-methoxy-7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-1-yl]-4-iodo-3-methylbut-3-enyl] acetate (PubChem CID 102595989) has the molecular formula C24H41IO6Si and a molecular weight of 580.58 g/mol. Its IUPAC name is [(E,1R)-1-[(1R,3S,4R,5S)-4-[(1S)-1-[tert-butyl(dimethyl)silyl]oxy-2-oxoethyl]-3-methoxy-7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-1-yl]-4-iodo-3-methylbut-3-enyl] acetate.
| Compound Name | [(E,1R)-1-[(1R,3S,4R,5S)-4-[(1S)-1-[tert-butyl(dimethyl)silyl]oxy-2-oxoethyl]-3-methoxy-7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-1-yl]-4-iodo-3-methylbut-3-enyl] acetate |
|---|---|
| PubChem CID | 102595989 |
| Molecular Formula | C24H41IO6Si |
| Molecular Weight | 580.58 g/mol |
| Exact Mass | 580.17 |
| IUPAC Name | [(E,1R)-1-[(1R,3S,4R,5S)-4-[(1S)-1-[tert-butyl(dimethyl)silyl]oxy-2-oxoethyl]-3-methoxy-7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-1-yl]-4-iodo-3-methylbut-3-enyl] acetate |
| SMILES | CO[C@H]1O[C@]2([C@@H](C/C(C)=C/I)OC(C)=O)[C@@H](CC2(C)C)[C@@H]1[C@@H](C=O)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C24H41IO6Si/c1-15(13-25)11-19(29-16(2)27)24-17(12-23(24,6)7)20(21(28-8)30-24)18(14-26)31-32(9,10)22(3,4)5/h13-14,17-21H,11-12H2,1-10H3/b15-13+/t17-,18+,19+,20+,21-,24-/m0/s1 |
| InChIKey | OURPTEXYNPXFNY-VNAZHYSZSA-N |
| XLogP | 5.64 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.58 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|