C30H57IO6Si2 — CID 102595988
[(E,1R)-1-[(1R,3S,4R,5S)-4-[(1S)-1-[tert-butyl(dimethyl)silyl]oxy-2-triethylsilyloxyethyl]-3-methoxy-7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-1-yl]-4-iodo-3-methylbut-3-enyl] acetate (PubChem CID 102595988) has the molecular formula C30H57IO6Si2 and a molecular weight of 696.86 g/mol. Its IUPAC name is [(E,1R)-1-[(1R,3S,4R,5S)-4-[(1S)-1-[tert-butyl(dimethyl)silyl]oxy-2-triethylsilyloxyethyl]-3-methoxy-7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-1-yl]-4-iodo-3-methylbut-3-enyl] acetate.
| Compound Name | [(E,1R)-1-[(1R,3S,4R,5S)-4-[(1S)-1-[tert-butyl(dimethyl)silyl]oxy-2-triethylsilyloxyethyl]-3-methoxy-7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-1-yl]-4-iodo-3-methylbut-3-enyl] acetate |
|---|---|
| PubChem CID | 102595988 |
| Molecular Formula | C30H57IO6Si2 |
| Molecular Weight | 696.86 g/mol |
| Exact Mass | 696.27 |
| IUPAC Name | [(E,1R)-1-[(1R,3S,4R,5S)-4-[(1S)-1-[tert-butyl(dimethyl)silyl]oxy-2-triethylsilyloxyethyl]-3-methoxy-7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-1-yl]-4-iodo-3-methylbut-3-enyl] acetate |
| SMILES | CC[Si](CC)(CC)OC[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1[C@@H](OC)O[C@]2([C@@H](C/C(C)=C/I)OC(C)=O)[C@H]1CC2(C)C |
| InChI | InChI=1S/C30H57IO6Si2/c1-14-39(15-2,16-3)34-20-24(37-38(12,13)28(6,7)8)26-23-18-29(9,10)30(23,36-27(26)33-11)25(35-22(5)32)17-21(4)19-31/h19,23-27H,14-18,20H2,1-13H3/b21-19+/t23-,24+,25+,26+,27-,30-/m0/s1 |
| InChIKey | VODPYTXFEVFQRA-UYODYCDJSA-N |
| XLogP | 8.46 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 696.86 |
| LogP ≤ 5 | 8.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|