C17H26O6 — CID 102596030
5-O-tert-butyl 4-O-ethyl (3R,4R)-6-methyl-2-oxo-3-propan-2-yl-3,4-dihydropyran-4,5-dicarboxylate (PubChem CID 102596030) has the molecular formula C17H26O6 and a molecular weight of 326.39 g/mol. Its IUPAC name is 5-O-tert-butyl 4-O-ethyl (3R,4R)-6-methyl-2-oxo-3-propan-2-yl-3,4-dihydropyran-4,5-dicarboxylate.
| Compound Name | 5-O-tert-butyl 4-O-ethyl (3R,4R)-6-methyl-2-oxo-3-propan-2-yl-3,4-dihydropyran-4,5-dicarboxylate |
|---|---|
| PubChem CID | 102596030 |
| Molecular Formula | C17H26O6 |
| Molecular Weight | 326.39 g/mol |
| Exact Mass | 326.17 |
| IUPAC Name | 5-O-tert-butyl 4-O-ethyl (3R,4R)-6-methyl-2-oxo-3-propan-2-yl-3,4-dihydropyran-4,5-dicarboxylate |
| SMILES | CCOC(=O)[C@H]1C(C(=O)OC(C)(C)C)=C(C)OC(=O)[C@@H]1C(C)C |
| InChI | InChI=1S/C17H26O6/c1-8-21-14(18)13-11(9(2)3)15(19)22-10(4)12(13)16(20)23-17(5,6)7/h9,11,13H,8H2,1-7H3/t11-,13-/m1/s1 |
| InChIKey | QOOZCJKSLWIPQS-DGCLKSJQSA-N |
| XLogP | 2.61 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.39 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|