C16H18O7 — CID 11141805
methyl (1R,15R,16S)-10-methyl-2,8-dioxo-3,7,11-trioxatricyclo[7.6.1.012,16]hexadeca-9,12-diene-15-carboxylate (PubChem CID 11141805) has the molecular formula C16H18O7 and a molecular weight of 322.31 g/mol. Its IUPAC name is methyl (1R,15R,16S)-10-methyl-2,8-dioxo-3,7,11-trioxatricyclo[7.6.1.012,16]hexadeca-9,12-diene-15-carboxylate.
| Compound Name | methyl (1R,15R,16S)-10-methyl-2,8-dioxo-3,7,11-trioxatricyclo[7.6.1.012,16]hexadeca-9,12-diene-15-carboxylate |
|---|---|
| PubChem CID | 11141805 |
| Molecular Formula | C16H18O7 |
| Molecular Weight | 322.31 g/mol |
| Exact Mass | 322.11 |
| IUPAC Name | methyl (1R,15R,16S)-10-methyl-2,8-dioxo-3,7,11-trioxatricyclo[7.6.1.012,16]hexadeca-9,12-diene-15-carboxylate |
| SMILES | COC(=O)[C@@H]1CC=C2OC(C)=C3C(=O)OCCCOC(=O)[C@@H]1[C@H]23 |
| InChI | InChI=1S/C16H18O7/c1-8-11-13-10(23-8)5-4-9(14(17)20-2)12(13)16(19)22-7-3-6-21-15(11)18/h5,9,12-13H,3-4,6-7H2,1-2H3/t9-,12+,13-/m1/s1 |
| InChIKey | YKRTYQJYMYRQFB-JIMOISOXSA-N |
| XLogP | 1.09 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.31 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|